C66H60N2 — CID 177269809
N-[1,1,2,2,3,3-hexamethyl-6-[4-(N-(4-phenylphenyl)anilino)phenyl]inden-5-yl]-9,9-dimethyl-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-2-amine (PubChem CID 177269809) has the molecular formula C66H60N2 and a molecular weight of 886.25 g/mol. Its IUPAC name is N-[1,1,2,2,3,3-hexamethyl-6-[4-(N-(4-phenylphenyl)anilino)phenyl]inden-5-yl]-9,9-dimethyl-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-2-amine.
| Compound Name | N-[1,1,2,2,3,3-hexamethyl-6-[4-(N-(4-phenylphenyl)anilino)phenyl]inden-5-yl]-9,9-dimethyl-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 177269809 |
| Molecular Formula | C66H60N2 |
| Molecular Weight | 886.25 g/mol |
| Exact Mass | 885.51 |
| IUPAC Name | N-[1,1,2,2,3,3-hexamethyl-6-[4-(N-(4-phenylphenyl)anilino)phenyl]inden-5-yl]-9,9-dimethyl-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3cc4c(cc3-c3ccc(N(c5ccccc5)c5ccc(-c6ccccc6)cc5)cc3)C(C)(C)C(C)(C)C4(C)C)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C66H60N2/c1-63(2)58-27-19-18-26-55(58)56-41-40-54(42-59(56)63)68(53-36-30-48(31-37-53)46-22-14-10-15-23-46)62-44-61-60(64(3,4)66(7,8)65(61,5)6)43-57(62)49-32-38-52(39-33-49)67(50-24-16-11-17-25-50)51-34-28-47(29-35-51)45-20-12-9-13-21-45/h9-44H,1-8H3/i10D,14D,15D,22D,23D |
| InChIKey | OYBIDBNVVWHBES-AVOCWWTPSA-N |
| XLogP | 18.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.25 |
| LogP ≤ 5 | 18.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |