C45H35BrN2 — CID 140867108
5-bromo-3-N-(9,9-dimethylfluoren-2-yl)-1-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1-N,3-N-diphenylbenzene-1,3-diamine (PubChem CID 140867108) has the molecular formula C45H35BrN2 and a molecular weight of 688.72 g/mol. Its IUPAC name is 5-bromo-3-N-(9,9-dimethylfluoren-2-yl)-1-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1-N,3-N-diphenylbenzene-1,3-diamine.
| Compound Name | 5-bromo-3-N-(9,9-dimethylfluoren-2-yl)-1-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1-N,3-N-diphenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 140867108 |
| Molecular Formula | C45H35BrN2 |
| Molecular Weight | 688.72 g/mol |
| Exact Mass | 687.23 |
| IUPAC Name | 5-bromo-3-N-(9,9-dimethylfluoren-2-yl)-1-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1-N,3-N-diphenylbenzene-1,3-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(N(c3ccccc3)c3cc(Br)cc(N(c4ccccc4)c4ccc5c(c4)C(C)(C)c4ccccc4-5)c3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H35BrN2/c1-45(2)43-21-13-12-20-41(43)42-27-26-38(31-44(42)45)48(36-18-10-5-11-19-36)40-29-34(46)28-39(30-40)47(35-16-8-4-9-17-35)37-24-22-33(23-25-37)32-14-6-3-7-15-32/h3-31H,1-2H3/i3D,6D,7D,14D,15D |
| InChIKey | NVLUOHCQUNKDSP-SNQSQISWSA-N |
| XLogP | 13.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.72 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |