C60H48N2 — CID 163994090
9,9-dimethyl-N-phenyl-N-[4-[4-[2,3,5,6-tetradeuterio-4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenyl]phenyl]phenyl]fluoren-2-amine (PubChem CID 163994090) has the molecular formula C60H48N2 and a molecular weight of 801.08 g/mol. Its IUPAC name is 9,9-dimethyl-N-phenyl-N-[4-[4-[2,3,5,6-tetradeuterio-4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenyl]phenyl]phenyl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-phenyl-N-[4-[4-[2,3,5,6-tetradeuterio-4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenyl]phenyl]phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 163994090 |
| Molecular Formula | C60H48N2 |
| Molecular Weight | 801.08 g/mol |
| Exact Mass | 800.41 |
| IUPAC Name | 9,9-dimethyl-N-phenyl-N-[4-[4-[2,3,5,6-tetradeuterio-4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenyl]phenyl]phenyl]fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccccc2)c2ccc3c(c2)C(C)(C)c2ccccc2-3)c([2H])c([2H])c1-c1ccc(-c2ccc(N(c3ccccc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)cc1 |
| InChI | InChI=1S/C60H48N2/c1-59(2)55-21-13-11-19-51(55)53-37-35-49(39-57(53)59)61(45-15-7-5-8-16-45)47-31-27-43(28-32-47)41-23-25-42(26-24-41)44-29-33-48(34-30-44)62(46-17-9-6-10-18-46)50-36-38-54-52-20-12-14-22-56(52)60(3,4)58(54)40-50/h5-40H,1-4H3/i27D,28D,31D,32D |
| InChIKey | VKPHGJYFFITPJW-UXAFZMSYSA-N |
| XLogP | 16.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.08 |
| LogP ≤ 5 | 16.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |