C61H42N2 — CID 168791398
2-N'-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-2-N'-(4-phenylphenyl)-9,9'-spirobi[fluorene]-2,2'-diamine (PubChem CID 168791398) has the molecular formula C61H42N2 and a molecular weight of 808.05 g/mol. Its IUPAC name is 2-N'-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-2-N'-(4-phenylphenyl)-9,9'-spirobi[fluorene]-2,2'-diamine.
| Compound Name | 2-N'-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-2-N'-(4-phenylphenyl)-9,9'-spirobi[fluorene]-2,2'-diamine |
|---|---|
| PubChem CID | 168791398 |
| Molecular Formula | C61H42N2 |
| Molecular Weight | 808.05 g/mol |
| Exact Mass | 807.37 |
| IUPAC Name | 2-N'-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-2-N'-(4-phenylphenyl)-9,9'-spirobi[fluorene]-2,2'-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccccc2N(c2ccc(-c3ccccc3)cc2)c2ccc3c(c2)C2(c4ccccc4-c4ccc(N(c5ccccc5)c5ccccc5)cc42)c2ccccc2-3)c([2H])c1[2H] |
| InChI | InChI=1S/C61H42N2/c1-5-19-43(20-6-1)44-33-35-48(36-34-44)63(60-32-18-15-27-51(60)45-21-7-2-8-22-45)50-38-40-55-53-29-14-17-31-57(53)61(59(55)42-50)56-30-16-13-28-52(56)54-39-37-49(41-58(54)61)62(46-23-9-3-10-24-46)47-25-11-4-12-26-47/h1-42H/i2D,7D,8D,21D,22D |
| InChIKey | RTRVDVKIZXVUTM-AOLXDSIBSA-N |
| XLogP | 16.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.05 |
| LogP ≤ 5 | 16.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |