C74H50N2 — CID 168791267
2-N'-(9,9-diphenylfluoren-4-yl)-2-N'-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine (PubChem CID 168791267) has the molecular formula C74H50N2 and a molecular weight of 972.26 g/mol. Its IUPAC name is 2-N'-(9,9-diphenylfluoren-4-yl)-2-N'-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine.
| Compound Name | 2-N'-(9,9-diphenylfluoren-4-yl)-2-N'-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
|---|---|
| PubChem CID | 168791267 |
| Molecular Formula | C74H50N2 |
| Molecular Weight | 972.26 g/mol |
| Exact Mass | 971.43 |
| IUPAC Name | 2-N'-(9,9-diphenylfluoren-4-yl)-2-N'-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(N(c3ccc4c(c3)C3(c5ccccc5-c5ccc(N(c6ccccc6)c6ccccc6)cc53)c3ccccc3-4)c3cccc4c3-c3ccccc3C4(c3ccccc3)c3ccccc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C74H50N2/c1-6-23-51(24-7-1)52-41-43-57(44-42-52)76(71-40-22-39-68-72(71)64-35-18-21-38-67(64)73(68,53-25-8-2-9-26-53)54-27-10-3-11-28-54)59-46-48-63-61-34-17-20-37-66(61)74(70(63)50-59)65-36-19-16-33-60(65)62-47-45-58(49-69(62)74)75(55-29-12-4-13-30-55)56-31-14-5-15-32-56/h1-50H/i1D,6D,7D,23D,24D |
| InChIKey | HETGGUONCLDRLA-JAELQNSBSA-N |
| XLogP | 19.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.26 |
| LogP ≤ 5 | 19.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |