C62H43N3 — CID 168791634
2-N'-(9-methylcarbazol-2-yl)-2-N'-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine (PubChem CID 168791634) has the molecular formula C62H43N3 and a molecular weight of 835.08 g/mol. Its IUPAC name is 2-N'-(9-methylcarbazol-2-yl)-2-N'-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine.
| Compound Name | 2-N'-(9-methylcarbazol-2-yl)-2-N'-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
|---|---|
| PubChem CID | 168791634 |
| Molecular Formula | C62H43N3 |
| Molecular Weight | 835.08 g/mol |
| Exact Mass | 834.38 |
| IUPAC Name | 2-N'-(9-methylcarbazol-2-yl)-2-N'-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccccc2N(c2ccc3c(c2)C2(c4ccccc4-c4ccc(N(c5ccccc5)c5ccccc5)cc42)c2ccccc2-3)c2ccc3c4ccccc4n(C)c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C62H43N3/c1-63-59-31-17-14-28-53(59)54-38-35-47(41-61(54)63)65(60-32-18-13-25-48(60)42-19-5-2-6-20-42)46-34-37-52-50-27-12-16-30-56(50)62(58(52)40-46)55-29-15-11-26-49(55)51-36-33-45(39-57(51)62)64(43-21-7-3-8-22-43)44-23-9-4-10-24-44/h2-41H,1H3/i2D,5D,6D,19D,20D |
| InChIKey | BOJGSVMZPYKCLY-VCZADUSTSA-N |
| XLogP | 16.28 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.08 |
| LogP ≤ 5 | 16.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |