C61H41N3 — CID 168791410
2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N'-diphenyl-2-N-(9-phenylcarbazol-4-yl)-9,9'-spirobi[fluorene]-2,2'-diamine (PubChem CID 168791410) has the molecular formula C61H41N3 and a molecular weight of 821.05 g/mol. Its IUPAC name is 2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N'-diphenyl-2-N-(9-phenylcarbazol-4-yl)-9,9'-spirobi[fluorene]-2,2'-diamine.
| Compound Name | 2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N'-diphenyl-2-N-(9-phenylcarbazol-4-yl)-9,9'-spirobi[fluorene]-2,2'-diamine |
|---|---|
| PubChem CID | 168791410 |
| Molecular Formula | C61H41N3 |
| Molecular Weight | 821.05 g/mol |
| Exact Mass | 820.36 |
| IUPAC Name | 2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N'-diphenyl-2-N-(9-phenylcarbazol-4-yl)-9,9'-spirobi[fluorene]-2,2'-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccccc2)c2ccc3c(c2)C2(c4ccccc4-3)c3ccccc3-c3ccc(N(c4ccccc4)c4cccc5c4c4ccccc4n5-c4ccccc4)cc32)c([2H])c1[2H] |
| InChI | InChI=1S/C61H41N3/c1-5-20-42(21-6-1)62(43-22-7-2-8-23-43)46-36-38-50-48-28-13-16-31-53(48)61(55(50)40-46)54-32-17-14-29-49(54)51-39-37-47(41-56(51)61)63(44-24-9-3-10-25-44)58-34-19-35-59-60(58)52-30-15-18-33-57(52)64(59)45-26-11-4-12-27-45/h1-41H/i1D,5D,6D,20D,21D |
| InChIKey | QDKXVBRAFZNAGW-HDJCPTMBSA-N |
| XLogP | 16.07 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.05 |
| LogP ≤ 5 | 16.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |