C56H39N3 — CID 168791348
2-N-(9-methylcarbazol-4-yl)-2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N'-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine (PubChem CID 168791348) has the molecular formula C56H39N3 and a molecular weight of 758.98 g/mol. Its IUPAC name is 2-N-(9-methylcarbazol-4-yl)-2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N'-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine.
| Compound Name | 2-N-(9-methylcarbazol-4-yl)-2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N'-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
|---|---|
| PubChem CID | 168791348 |
| Molecular Formula | C56H39N3 |
| Molecular Weight | 758.98 g/mol |
| Exact Mass | 758.35 |
| IUPAC Name | 2-N-(9-methylcarbazol-4-yl)-2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N'-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccccc2)c2ccc3c(c2)C2(c4ccccc4-3)c3ccccc3-c3ccc(N(c4ccccc4)c4cccc5c4c4ccccc4n5C)cc32)c([2H])c1[2H] |
| InChI | InChI=1S/C56H39N3/c1-57-52-29-16-13-26-47(52)55-53(57)30-17-31-54(55)59(40-22-9-4-10-23-40)42-33-35-46-44-25-12-15-28-49(44)56(51(46)37-42)48-27-14-11-24-43(48)45-34-32-41(36-50(45)56)58(38-18-5-2-6-19-38)39-20-7-3-8-21-39/h2-37H,1H3/i2D,5D,6D,18D,19D |
| InChIKey | FEDQBAGVJUTXMH-GTHNAFMHSA-N |
| XLogP | 14.61 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.98 |
| LogP ≤ 5 | 14.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |