C61H40N2S — CID 168791403
2-N'-dibenzothiophen-1-yl-2-N'-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine (PubChem CID 168791403) has the molecular formula C61H40N2S and a molecular weight of 838.10 g/mol. Its IUPAC name is 2-N'-dibenzothiophen-1-yl-2-N'-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine.
| Compound Name | 2-N'-dibenzothiophen-1-yl-2-N'-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
|---|---|
| PubChem CID | 168791403 |
| Molecular Formula | C61H40N2S |
| Molecular Weight | 838.10 g/mol |
| Exact Mass | 837.32 |
| IUPAC Name | 2-N'-dibenzothiophen-1-yl-2-N'-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(N(c3ccc4c(c3)C3(c5ccccc5-c5ccc(N(c6ccccc6)c6ccccc6)cc53)c3ccccc3-4)c3cccc4sc5ccccc5c34)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C61H40N2S/c1-4-18-41(19-5-1)42-20-16-25-45(38-42)63(57-31-17-33-59-60(57)52-28-12-15-32-58(52)64-59)47-35-37-51-49-27-11-14-30-54(49)61(56(51)40-47)53-29-13-10-26-48(53)50-36-34-46(39-55(50)61)62(43-21-6-2-7-22-43)44-23-8-3-9-24-44/h1-40H/i1D,4D,5D,18D,19D |
| InChIKey | UMEYJPKKGGLVOS-BRRJAKNXSA-N |
| XLogP | 17.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.10 |
| LogP ≤ 5 | 17.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |