C53H36N2 — CID 168791654
2-N-naphthalen-1-yl-2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N'-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine (PubChem CID 168791654) has the molecular formula C53H36N2 and a molecular weight of 705.92 g/mol. Its IUPAC name is 2-N-naphthalen-1-yl-2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N'-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine.
| Compound Name | 2-N-naphthalen-1-yl-2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N'-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
|---|---|
| PubChem CID | 168791654 |
| Molecular Formula | C53H36N2 |
| Molecular Weight | 705.92 g/mol |
| Exact Mass | 705.32 |
| IUPAC Name | 2-N-naphthalen-1-yl-2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N'-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccccc2)c2ccc3c(c2)C2(c4ccccc4-3)c3ccccc3-c3ccc(N(c4ccccc4)c4cccc5ccccc45)cc32)c([2H])c1[2H] |
| InChI | InChI=1S/C53H36N2/c1-4-19-38(20-5-1)54(39-21-6-2-7-22-39)41-31-33-46-44-26-12-14-28-48(44)53(50(46)35-41)49-29-15-13-27-45(49)47-34-32-42(36-51(47)53)55(40-23-8-3-9-24-40)52-30-16-18-37-17-10-11-25-43(37)52/h1-36H/i1D,4D,5D,19D,20D |
| InChIKey | FHSLYODHPPAYSP-JIOYQBSQSA-N |
| XLogP | 14.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.92 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |