C55H36N2O — CID 168791333
3-N-dibenzofuran-4-yl-2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N',3-N-diphenyl-9,9'-spirobi[fluorene]-2',3-diamine (PubChem CID 168791333) has the molecular formula C55H36N2O and a molecular weight of 745.94 g/mol. Its IUPAC name is 3-N-dibenzofuran-4-yl-2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N',3-N-diphenyl-9,9'-spirobi[fluorene]-2',3-diamine.
| Compound Name | 3-N-dibenzofuran-4-yl-2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N',3-N-diphenyl-9,9'-spirobi[fluorene]-2',3-diamine |
|---|---|
| PubChem CID | 168791333 |
| Molecular Formula | C55H36N2O |
| Molecular Weight | 745.94 g/mol |
| Exact Mass | 745.31 |
| IUPAC Name | 3-N-dibenzofuran-4-yl-2-N'-(2,3,4,5,6-pentadeuteriophenyl)-2-N',3-N-diphenyl-9,9'-spirobi[fluorene]-2',3-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccccc2)c2ccc3c(c2)C2(c4ccccc4-c4cc(N(c5ccccc5)c5cccc6c5oc5ccccc56)ccc42)c2ccccc2-3)c([2H])c1[2H] |
| InChI | InChI=1S/C55H36N2O/c1-4-17-37(18-5-1)56(38-19-6-2-7-20-38)41-31-33-44-42-23-10-13-27-48(42)55(51(44)36-41)49-28-14-11-24-43(49)47-35-40(32-34-50(47)55)57(39-21-8-3-9-22-39)52-29-16-26-46-45-25-12-15-30-53(45)58-54(46)52/h1-36H/i1D,4D,5D,17D,18D |
| InChIKey | QHPNLAIZWIVVKI-OCAOJUBNSA-N |
| XLogP | 14.87 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.94 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |