C64H44N2S — CID 168791436
2-N'-dibenzothiophen-4-yl-2-N'-(9,9-dimethylfluoren-2-yl)-2-N-(2,3,4,5,6-pentadeuteriophenyl)-2-N-phenyl-9,9'-spirobi[fluorene]-2,2'-diamine (PubChem CID 168791436) has the molecular formula C64H44N2S and a molecular weight of 878.17 g/mol. Its IUPAC name is 2-N'-dibenzothiophen-4-yl-2-N'-(9,9-dimethylfluoren-2-yl)-2-N-(2,3,4,5,6-pentadeuteriophenyl)-2-N-phenyl-9,9'-spirobi[fluorene]-2,2'-diamine.
| Compound Name | 2-N'-dibenzothiophen-4-yl-2-N'-(9,9-dimethylfluoren-2-yl)-2-N-(2,3,4,5,6-pentadeuteriophenyl)-2-N-phenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
|---|---|
| PubChem CID | 168791436 |
| Molecular Formula | C64H44N2S |
| Molecular Weight | 878.17 g/mol |
| Exact Mass | 877.35 |
| IUPAC Name | 2-N'-dibenzothiophen-4-yl-2-N'-(9,9-dimethylfluoren-2-yl)-2-N-(2,3,4,5,6-pentadeuteriophenyl)-2-N-phenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccccc2)c2ccc3c(c2)C2(c4ccccc4-3)c3ccccc3-c3ccc(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4cccc5c4sc4ccccc45)cc32)c([2H])c1[2H] |
| InChI | InChI=1S/C64H44N2S/c1-63(2)54-27-13-9-22-46(54)49-35-33-44(38-57(49)63)66(60-30-17-26-53-52-25-12-16-31-61(52)67-62(53)60)45-34-37-51-48-24-11-15-29-56(48)64(59(51)40-45)55-28-14-10-23-47(55)50-36-32-43(39-58(50)64)65(41-18-5-3-6-19-41)42-20-7-4-8-21-42/h3-40H,1-2H3/i3D,5D,6D,18D,19D |
| InChIKey | QQKFHKVMHXOIGN-DQKOYMBESA-N |
| XLogP | 17.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.17 |
| LogP ≤ 5 | 17.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |