C71H49N3 — CID 156687529
9-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-3-N,6-N,6-N-triphenyl-9-(9-phenylcarbazol-4-yl)-3-N-(2-phenylphenyl)fluorene-3,6-diamine (PubChem CID 156687529) has the molecular formula C71H49N3 and a molecular weight of 951.24 g/mol. Its IUPAC name is 9-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-3-N,6-N,6-N-triphenyl-9-(9-phenylcarbazol-4-yl)-3-N-(2-phenylphenyl)fluorene-3,6-diamine.
| Compound Name | 9-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-3-N,6-N,6-N-triphenyl-9-(9-phenylcarbazol-4-yl)-3-N-(2-phenylphenyl)fluorene-3,6-diamine |
|---|---|
| PubChem CID | 156687529 |
| Molecular Formula | C71H49N3 |
| Molecular Weight | 951.24 g/mol |
| Exact Mass | 950.44 |
| IUPAC Name | 9-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-3-N,6-N,6-N-triphenyl-9-(9-phenylcarbazol-4-yl)-3-N-(2-phenylphenyl)fluorene-3,6-diamine |
| SMILES | [2H]c1c([2H])c([2H])c2c(C3(c4cccc5c4c4ccccc4n5-c4ccccc4)c4ccc(N(c5ccccc5)c5ccccc5)cc4-c4cc(N(c5ccccc5)c5ccccc5-c5ccccc5)ccc43)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C71H49N3/c1-6-24-51(25-7-1)59-37-18-20-41-67(59)73(54-32-12-4-13-33-54)57-45-47-65-62(49-57)61-48-56(72(52-28-8-2-9-29-52)53-30-10-3-11-31-53)44-46-64(61)71(65,63-39-22-27-50-26-16-17-36-58(50)63)66-40-23-43-69-70(66)60-38-19-21-42-68(60)74(69)55-34-14-5-15-35-55/h1-49H/i16D,17D,22D,26D,27D,36D,39D |
| InChIKey | XKTNSNSJUQVKBB-PECNLGPBSA-N |
| XLogP | 18.91 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.24 |
| LogP ≤ 5 | 18.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |