C70H50N2 — CID 168791446
2-N'-(9,9-dimethylfluoren-2-yl)-2-N'-[4-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine (PubChem CID 168791446) has the molecular formula C70H50N2 and a molecular weight of 924.21 g/mol. Its IUPAC name is 2-N'-(9,9-dimethylfluoren-2-yl)-2-N'-[4-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine.
| Compound Name | 2-N'-(9,9-dimethylfluoren-2-yl)-2-N'-[4-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
|---|---|
| PubChem CID | 168791446 |
| Molecular Formula | C70H50N2 |
| Molecular Weight | 924.21 g/mol |
| Exact Mass | 923.43 |
| IUPAC Name | 2-N'-(9,9-dimethylfluoren-2-yl)-2-N'-[4-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccccc2-c2ccc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4c(c3)C3(c5ccccc5-c5ccc(N(c6ccccc6)c6ccccc6)cc53)c3ccccc3-4)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C70H50N2/c1-69(2)63-31-17-14-28-57(63)60-41-38-52(44-66(60)69)72(51-36-34-48(35-37-51)56-27-13-12-26-55(56)47-20-6-3-7-21-47)54-40-43-62-59-30-16-19-33-65(59)70(68(62)46-54)64-32-18-15-29-58(64)61-42-39-53(45-67(61)70)71(49-22-8-4-9-23-49)50-24-10-5-11-25-50/h3-46H,1-2H3/i3D,6D,7D,20D,21D |
| InChIKey | YKPMSJXHJBMTLJ-OOBRMTQKSA-N |
| XLogP | 18.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.21 |
| LogP ≤ 5 | 18.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |