C62H44N2 — CID 168791364
2-N'-(9,9-dimethylfluoren-2-yl)-2-N'-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine (PubChem CID 168791364) has the molecular formula C62H44N2 and a molecular weight of 824.09 g/mol. Its IUPAC name is 2-N'-(9,9-dimethylfluoren-2-yl)-2-N'-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine.
| Compound Name | 2-N'-(9,9-dimethylfluoren-2-yl)-2-N'-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
|---|---|
| PubChem CID | 168791364 |
| Molecular Formula | C62H44N2 |
| Molecular Weight | 824.09 g/mol |
| Exact Mass | 823.39 |
| IUPAC Name | 2-N'-(9,9-dimethylfluoren-2-yl)-2-N'-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-2-N,2-N-diphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4c(c3)C3(c5ccccc5-c5ccc(N(c6ccccc6)c6ccccc6)cc53)c3ccccc3-4)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C62H44N2/c1-61(2)55-26-14-11-23-49(55)52-34-31-46(38-58(52)61)64(45-30-29-41-17-9-10-18-42(41)37-45)48-33-36-54-51-25-13-16-28-57(51)62(60(54)40-48)56-27-15-12-24-50(56)53-35-32-47(39-59(53)62)63(43-19-5-3-6-20-43)44-21-7-4-8-22-44/h3-40H,1-2H3/i9D,10D,17D,18D,29D,30D,37D |
| InChIKey | JSCWVERBEIGOAX-AKVCQHRDSA-N |
| XLogP | 16.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.09 |
| LogP ≤ 5 | 16.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |