C64H46N2 — CID 168791346
2-N'-(9,9-dimethylfluoren-2-yl)-2-N-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N',1'-triphenyl-9,9'-spirobi[fluorene]-2,2'-diamine (PubChem CID 168791346) has the molecular formula C64H46N2 and a molecular weight of 848.12 g/mol. Its IUPAC name is 2-N'-(9,9-dimethylfluoren-2-yl)-2-N-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N',1'-triphenyl-9,9'-spirobi[fluorene]-2,2'-diamine.
| Compound Name | 2-N'-(9,9-dimethylfluoren-2-yl)-2-N-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N',1'-triphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
|---|---|
| PubChem CID | 168791346 |
| Molecular Formula | C64H46N2 |
| Molecular Weight | 848.12 g/mol |
| Exact Mass | 847.40 |
| IUPAC Name | 2-N'-(9,9-dimethylfluoren-2-yl)-2-N-(2,3,4,5,6-pentadeuteriophenyl)-2-N,2-N',1'-triphenyl-9,9'-spirobi[fluorene]-2,2'-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccccc2)c2ccc3c(c2)C2(c4ccccc4-3)c3ccccc3-c3ccc(N(c4ccccc4)c4ccc5c(c4)C(C)(C)c4ccccc4-5)c(-c4ccccc4)c32)c([2H])c1[2H] |
| InChI | InChI=1S/C64H46N2/c1-63(2)55-32-18-15-29-49(55)52-37-36-48(41-58(52)63)66(46-27-13-6-14-28-46)60-40-39-54-51-31-17-20-34-57(51)64(62(54)61(60)43-21-7-3-8-22-43)56-33-19-16-30-50(56)53-38-35-47(42-59(53)64)65(44-23-9-4-10-24-44)45-25-11-5-12-26-45/h3-42H,1-2H3/i4D,9D,10D,23D,24D |
| InChIKey | ULOZXQXTCYQPKK-AMYKWAQNSA-N |
| XLogP | 16.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.12 |
| LogP ≤ 5 | 16.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |