C51H50BrN — CID 177269906
N-[4-(6-bromo-1,1,2,2,3,3-hexamethylinden-5-yl)-2,3,5,6-tetradeuteriophenyl]-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-amine (PubChem CID 177269906) has the molecular formula C51H50BrN and a molecular weight of 760.90 g/mol. Its IUPAC name is N-[4-(6-bromo-1,1,2,2,3,3-hexamethylinden-5-yl)-2,3,5,6-tetradeuteriophenyl]-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-amine.
| Compound Name | N-[4-(6-bromo-1,1,2,2,3,3-hexamethylinden-5-yl)-2,3,5,6-tetradeuteriophenyl]-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-amine |
|---|---|
| PubChem CID | 177269906 |
| Molecular Formula | C51H50BrN |
| Molecular Weight | 760.90 g/mol |
| Exact Mass | 759.34 |
| IUPAC Name | N-[4-(6-bromo-1,1,2,2,3,3-hexamethylinden-5-yl)-2,3,5,6-tetradeuteriophenyl]-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2ccc3c(c2)C(C)(C)c2ccccc2-3)c([2H])c([2H])c1-c1cc2c(cc1Br)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C51H50BrN/c1-47(2)40-17-13-11-15-35(40)37-25-23-33(27-42(37)47)53(34-24-26-38-36-16-12-14-18-41(36)48(3,4)43(38)28-34)32-21-19-31(20-22-32)39-29-44-45(30-46(39)52)50(7,8)51(9,10)49(44,5)6/h11-30H,1-10H3/i19D,20D,21D,22D |
| InChIKey | YRCTYSCMEVSIGO-BSCVOGSSSA-N |
| XLogP | 14.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.90 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |