C18H21F — CID 142891538
ethane;9-fluoro-2,7,9-trimethylfluorene (PubChem CID 142891538) has the molecular formula C18H21F and a molecular weight of 256.36 g/mol. Its IUPAC name is ethane;9-fluoro-2,7,9-trimethylfluorene.
| Compound Name | ethane;9-fluoro-2,7,9-trimethylfluorene |
|---|---|
| PubChem CID | 142891538 |
| Molecular Formula | C18H21F |
| Molecular Weight | 256.36 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | ethane;9-fluoro-2,7,9-trimethylfluorene |
| SMILES | CC.Cc1ccc2c(c1)C(C)(F)c1cc(C)ccc1-2 |
| InChI | InChI=1S/C16H15F.C2H6/c1-10-4-6-12-13-7-5-11(2)9-15(13)16(3,17)14(12)8-10;1-2/h4-9H,1-3H3;1-2H3 |
| InChIKey | SVAIIZABYBKOHG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.36 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |