C17H14F2 — CID 163562486
1,1-difluoro-2'-methylspiro[cyclobutane-3,9'-fluorene] (PubChem CID 163562486) has the molecular formula C17H14F2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 1,1-difluoro-2'-methylspiro[cyclobutane-3,9'-fluorene].
| Compound Name | 1,1-difluoro-2'-methylspiro[cyclobutane-3,9'-fluorene] |
|---|---|
| PubChem CID | 163562486 |
| Molecular Formula | C17H14F2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1,1-difluoro-2'-methylspiro[cyclobutane-3,9'-fluorene] |
| SMILES | Cc1ccc2c(c1)C1(CC(F)(F)C1)c1ccccc1-2 |
| InChI | InChI=1S/C17H14F2/c1-11-6-7-13-12-4-2-3-5-14(12)16(15(13)8-11)9-17(18,19)10-16/h2-8H,9-10H2,1H3 |
| InChIKey | FSKOOKAMBANXOX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |