C18H19N — CID 59757185
1',2-dimethylspiro[fluorene-9,3'-pyrrolidine] (PubChem CID 59757185) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 1',2-dimethylspiro[fluorene-9,3'-pyrrolidine].
| Compound Name | 1',2-dimethylspiro[fluorene-9,3'-pyrrolidine] |
|---|---|
| PubChem CID | 59757185 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1',2-dimethylspiro[fluorene-9,3'-pyrrolidine] |
| SMILES | Cc1ccc2c(c1)C1(CCN(C)C1)c1ccccc1-2 |
| InChI | InChI=1S/C18H19N/c1-13-7-8-15-14-5-3-4-6-16(14)18(17(15)11-13)9-10-19(2)12-18/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | BQPVBRWCIGSDMS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |