About (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine]
(3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine] (PubChem CID 124642213) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine].
Molecular Properties
| Compound Name | (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine] |
| PubChem CID | 124642213 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine] |
| SMILES | COC1=Nc2ccccc2[C@]12CCN(C)C2 |
| InChI | InChI=1S/C13H16N2O/c1-15-8-7-13(9-15)10-5-3-4-6-11(10)14-12(13)16-2/h3-6H,7-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | ZUUAQWLDDHDCGQ-CYBMUJFWSA-N |
| XLogP | 1.95 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine]?
The IUPAC name of (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine] (CID 124642213) is (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine].
What is the SMILES notation for (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine]?
The canonical SMILES for (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine] is COC1=Nc2ccccc2[C@]12CCN(C)C2.
What is the InChIKey of (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine]?
The InChIKey is ZUUAQWLDDHDCGQ-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H16N2O/c1-15-8-7-13(9-15)10-5-3-4-6-11(10)14-12(13)16-2/h3-6H,7-9H2,1-2H3/t13-/m1/s1.
What are the key properties of (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine]?
(3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine] has a molecular weight of 216.28 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine] is sourced from PubChem (CID 124642213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).