C13H16N2O — CID 124642213
(3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine] (PubChem CID 124642213) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine].
| Compound Name | (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine] |
|---|---|
| PubChem CID | 124642213 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (3S)-2-methoxy-1'-methylspiro[indole-3,3'-pyrrolidine] |
| SMILES | COC1=Nc2ccccc2[C@]12CCN(C)C2 |
| InChI | InChI=1S/C13H16N2O/c1-15-8-7-13(9-15)10-5-3-4-6-11(10)14-12(13)16-2/h3-6H,7-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | ZUUAQWLDDHDCGQ-CYBMUJFWSA-N |
| XLogP | 1.95 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |