methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate

C20H21NO2 — CID 23151716

IUPACmethyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate
SMILESCOC(=O)c1ccc2c(c1)C1(CCN(C)CC1)c1ccccc1-2
InChIInChI=1S/C20H21NO2/c1-21-11-9-20(10-12-21)17-6-4-3-5-15(17)16-8-7-14(13-18(16)20)19(22)23-2/h3-8,13H,9-12H2,1-2H3
InChIKeyQJHPUXULKPWBFP-UHFFFAOYSA-N
MW307.39 g/mol
LogP3.47
Rot. Bonds1

About methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate

methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate (PubChem CID 23151716) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate.

Molecular Properties

Compound Namemethyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate
PubChem CID23151716
Molecular FormulaC20H21NO2
Molecular Weight307.39 g/mol
Exact Mass307.16
IUPAC Namemethyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate
SMILESCOC(=O)c1ccc2c(c1)C1(CCN(C)CC1)c1ccccc1-2
InChIInChI=1S/C20H21NO2/c1-21-11-9-20(10-12-21)17-6-4-3-5-15(17)16-8-7-14(13-18(16)20)19(22)23-2/h3-8,13H,9-12H2,1-2H3
InChIKeyQJHPUXULKPWBFP-UHFFFAOYSA-N
XLogP3.47
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.39
LogP ≤ 53.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate?
The IUPAC name of methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate (CID 23151716) is methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate.
What is the SMILES notation for methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate?
The canonical SMILES for methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate is COC(=O)c1ccc2c(c1)C1(CCN(C)CC1)c1ccccc1-2.
What is the InChIKey of methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate?
The InChIKey is QJHPUXULKPWBFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO2/c1-21-11-9-20(10-12-21)17-6-4-3-5-15(17)16-8-7-14(13-18(16)20)19(22)23-2/h3-8,13H,9-12H2,1-2H3.
What are the key properties of methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate?
methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate has a molecular weight of 307.39 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1'-methylspiro[fluorene-9,4'-piperidine]-2-carboxylate is sourced from PubChem (CID 23151716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).