C29H20O4 — CID 634796
dimethyl 9,9'-spirobi[fluorene]-2,2'-dicarboxylate (PubChem CID 634796) has the molecular formula C29H20O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is dimethyl 9,9'-spirobi[fluorene]-2,2'-dicarboxylate.
| Compound Name | dimethyl 9,9'-spirobi[fluorene]-2,2'-dicarboxylate |
|---|---|
| PubChem CID | 634796 |
| Molecular Formula | C29H20O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | dimethyl 9,9'-spirobi[fluorene]-2,2'-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C1(c3ccccc3-2)c2ccccc2-c2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C29H20O4/c1-32-27(30)17-11-13-21-19-7-3-5-9-23(19)29(25(21)15-17)24-10-6-4-8-20(24)22-14-12-18(16-26(22)29)28(31)33-2/h3-16H,1-2H3 |
| InChIKey | ZXKHDOBFCYKLGW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |