C41H28BrNO4 — CID 176528100
dimethyl 5-bromo-2-[N-(9,9'-spirobi[fluorene]-2-yl)anilino]benzene-1,3-dicarboxylate (PubChem CID 176528100) has the molecular formula C41H28BrNO4 and a molecular weight of 678.58 g/mol. Its IUPAC name is dimethyl 5-bromo-2-[N-(9,9'-spirobi[fluorene]-2-yl)anilino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-bromo-2-[N-(9,9'-spirobi[fluorene]-2-yl)anilino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 176528100 |
| Molecular Formula | C41H28BrNO4 |
| Molecular Weight | 678.58 g/mol |
| Exact Mass | 677.12 |
| IUPAC Name | dimethyl 5-bromo-2-[N-(9,9'-spirobi[fluorene]-2-yl)anilino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Br)cc(C(=O)OC)c1N(c1ccccc1)c1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1ccccc1-2 |
| InChI | InChI=1S/C41H28BrNO4/c1-46-39(44)32-22-25(42)23-33(40(45)47-2)38(32)43(26-12-4-3-5-13-26)27-20-21-31-30-16-8-11-19-36(30)41(37(31)24-27)34-17-9-6-14-28(34)29-15-7-10-18-35(29)41/h3-24H,1-2H3 |
| InChIKey | IEXAYDBQJKYWPJ-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.58 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |