methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate

C22H18BrNO3 — CID 71127556

IUPACmethyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate
SMILESCOC(=O)c1cccc(C(C)=O)c1N(c1ccccc1)c1ccc(Br)cc1
InChIInChI=1S/C22H18BrNO3/c1-15(25)19-9-6-10-20(22(26)27-2)21(19)24(17-7-4-3-5-8-17)18-13-11-16(23)12-14-18/h3-14H,1-2H3
InChIKeySAFWROANSAQXLK-UHFFFAOYSA-N
MW424.29 g/mol
LogP5.91
Rot. Bonds5

About methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate

methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate (PubChem CID 71127556) has the molecular formula C22H18BrNO3 and a molecular weight of 424.29 g/mol. Its IUPAC name is methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate.

Molecular Properties

Compound Namemethyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate
PubChem CID71127556
Molecular FormulaC22H18BrNO3
Molecular Weight424.29 g/mol
Exact Mass423.05
IUPAC Namemethyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate
SMILESCOC(=O)c1cccc(C(C)=O)c1N(c1ccccc1)c1ccc(Br)cc1
InChIInChI=1S/C22H18BrNO3/c1-15(25)19-9-6-10-20(22(26)27-2)21(19)24(17-7-4-3-5-8-17)18-13-11-16(23)12-14-18/h3-14H,1-2H3
InChIKeySAFWROANSAQXLK-UHFFFAOYSA-N
XLogP5.91
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500424.29
LogP ≤ 55.91
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate?
The IUPAC name of methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate (CID 71127556) is methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate.
What is the SMILES notation for methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate?
The canonical SMILES for methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate is COC(=O)c1cccc(C(C)=O)c1N(c1ccccc1)c1ccc(Br)cc1.
What is the InChIKey of methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate?
The InChIKey is SAFWROANSAQXLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18BrNO3/c1-15(25)19-9-6-10-20(22(26)27-2)21(19)24(17-7-4-3-5-8-17)18-13-11-16(23)12-14-18/h3-14H,1-2H3.
What are the key properties of methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate?
methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate has a molecular weight of 424.29 g/mol, XLogP of 5.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-acetyl-2-(N-(4-bromophenyl)anilino)benzoate is sourced from PubChem (CID 71127556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).