C34H28N2O4 — CID 18332104
dimethyl 2,5-bis(N-phenylanilino)benzene-1,4-dicarboxylate (PubChem CID 18332104) has the molecular formula C34H28N2O4 and a molecular weight of 528.61 g/mol. Its IUPAC name is dimethyl 2,5-bis(N-phenylanilino)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2,5-bis(N-phenylanilino)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 18332104 |
| Molecular Formula | C34H28N2O4 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | dimethyl 2,5-bis(N-phenylanilino)benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1cc(N(c2ccccc2)c2ccccc2)c(C(=O)OC)cc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H28N2O4/c1-39-33(37)29-23-32(36(27-19-11-5-12-20-27)28-21-13-6-14-22-28)30(34(38)40-2)24-31(29)35(25-15-7-3-8-16-25)26-17-9-4-10-18-26/h3-24H,1-2H3 |
| InChIKey | NLACEGVNBLSJGR-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |