About 9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate
9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate (PubChem CID 162219375) has the molecular formula C40H33BrN2O4
and a molecular weight of 685.62 g/mol. Its IUPAC name is 9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate.
Molecular Properties
| Compound Name | 9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate |
| PubChem CID | 162219375 |
| Molecular Formula | C40H33BrN2O4 |
| Molecular Weight | 685.62 g/mol |
| Exact Mass | 684.16 |
| IUPAC Name | 9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate |
| SMILES | COC(=O)c1ccccc1Br.COC(=O)c1ccccc1N(c1ccccc1)c1ccccc1.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C20H17NO2.C12H9N.C8H7BrO2/c1-23-20(22)18-14-8-9-15-19(18)21(16-10-4-2-5-11-16)17-12-6-3-7-13-17;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-11-8(10)6-4-2-3-5-7(6)9/h2-15H,1H3;1-8,13H;2-5H,1H3 |
| InChIKey | ZTXKMGUWKRTWCW-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 685.62 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate?
The IUPAC name of 9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate (CID 162219375) is 9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate.
What is the SMILES notation for 9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate?
The canonical SMILES for 9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate is COC(=O)c1ccccc1Br.COC(=O)c1ccccc1N(c1ccccc1)c1ccccc1.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate?
The InChIKey is ZTXKMGUWKRTWCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO2.C12H9N.C8H7BrO2/c1-23-20(22)18-14-8-9-15-19(18)21(16-10-4-2-5-11-16)17-12-6-3-7-13-17;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-11-8(10)6-4-2-3-5-7(6)9/h2-15H,1H3;1-8,13H;2-5H,1H3.
What are the key properties of 9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate?
9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate has a molecular weight of 685.62 g/mol, XLogP of 10.50, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;methyl 2-bromobenzoate;methyl 2-(N-phenylanilino)benzoate is sourced from PubChem (CID 162219375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).