C64H51BrN2O4 — CID 161007877
methyl 2-bromobenzoate;methyl 2-(4-phenyl-N-(4-phenylphenyl)anilino)benzoate;4-phenyl-N-(4-phenylphenyl)aniline (PubChem CID 161007877) has the molecular formula C64H51BrN2O4 and a molecular weight of 992.03 g/mol. Its IUPAC name is methyl 2-bromobenzoate;methyl 2-(4-phenyl-N-(4-phenylphenyl)anilino)benzoate;4-phenyl-N-(4-phenylphenyl)aniline.
| Compound Name | methyl 2-bromobenzoate;methyl 2-(4-phenyl-N-(4-phenylphenyl)anilino)benzoate;4-phenyl-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 161007877 |
| Molecular Formula | C64H51BrN2O4 |
| Molecular Weight | 992.03 g/mol |
| Exact Mass | 990.30 |
| IUPAC Name | methyl 2-bromobenzoate;methyl 2-(4-phenyl-N-(4-phenylphenyl)anilino)benzoate;4-phenyl-N-(4-phenylphenyl)aniline |
| SMILES | COC(=O)c1ccccc1Br.COC(=O)c1ccccc1N(c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccc(Nc3ccc(-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H25NO2.C24H19N.C8H7BrO2/c1-35-32(34)30-14-8-9-15-31(30)33(28-20-16-26(17-21-28)24-10-4-2-5-11-24)29-22-18-27(19-23-29)25-12-6-3-7-13-25;1-3-7-19(8-4-1)21-11-15-23(16-12-21)25-24-17-13-22(14-18-24)20-9-5-2-6-10-20;1-11-8(10)6-4-2-3-5-7(6)9/h2-23H,1H3;1-18,25H;2-5H,1H3 |
| InChIKey | TWSZIXWOIGJOQQ-UHFFFAOYSA-N |
| XLogP | 17.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 992.03 |
| LogP ≤ 5 | 17.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |