About methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate
methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate (PubChem CID 141272509) has the molecular formula C13H9BrN2O2
and a molecular weight of 305.13 g/mol. Its IUPAC name is methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate |
| PubChem CID | 141272509 |
| Molecular Formula | C13H9BrN2O2 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate |
| SMILES | COC(=O)c1cc(Br)nc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C13H9BrN2O2/c1-18-13(17)8-6-10(14)16-11-7-4-2-3-5-9(7)15-12(8)11/h2-6,15H,1H3 |
| InChIKey | VJZCZTLZFFFPSC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate?
The IUPAC name of methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate (CID 141272509) is methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate.
What is the SMILES notation for methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate?
The canonical SMILES for methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate is COC(=O)c1cc(Br)nc2c1[nH]c1ccccc12.
What is the InChIKey of methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate?
The InChIKey is VJZCZTLZFFFPSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrN2O2/c1-18-13(17)8-6-10(14)16-11-7-4-2-3-5-9(7)15-12(8)11/h2-6,15H,1H3.
What are the key properties of methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate?
methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate has a molecular weight of 305.13 g/mol, XLogP of 3.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate is sourced from PubChem (CID 141272509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).