C13H9BrN2O2 — CID 141272509
methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate (PubChem CID 141272509) has the molecular formula C13H9BrN2O2 and a molecular weight of 305.13 g/mol. Its IUPAC name is methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate.
| Compound Name | methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 141272509 |
| Molecular Formula | C13H9BrN2O2 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | methyl 2-bromo-5H-pyrido[3,2-b]indole-4-carboxylate |
| SMILES | COC(=O)c1cc(Br)nc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C13H9BrN2O2/c1-18-13(17)8-6-10(14)16-11-7-4-2-3-5-9(7)15-12(8)11/h2-6,15H,1H3 |
| InChIKey | VJZCZTLZFFFPSC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|