C17H15NO4 — CID 132503759
dimethyl 4-methyl-9H-carbazole-1,3-dicarboxylate (PubChem CID 132503759) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is dimethyl 4-methyl-9H-carbazole-1,3-dicarboxylate.
| Compound Name | dimethyl 4-methyl-9H-carbazole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 132503759 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | dimethyl 4-methyl-9H-carbazole-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)c2[nH]c3ccccc3c2c1C |
| InChI | InChI=1S/C17H15NO4/c1-9-11(16(19)21-2)8-12(17(20)22-3)15-14(9)10-6-4-5-7-13(10)18-15/h4-8,18H,1-3H3 |
| InChIKey | QUAIQQFIEDTDQO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |