C14H10N2O3 — CID 141272491
methyl 2-formyl-5H-pyrido[3,2-b]indole-4-carboxylate (PubChem CID 141272491) has the molecular formula C14H10N2O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is methyl 2-formyl-5H-pyrido[3,2-b]indole-4-carboxylate.
| Compound Name | methyl 2-formyl-5H-pyrido[3,2-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 141272491 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | methyl 2-formyl-5H-pyrido[3,2-b]indole-4-carboxylate |
| SMILES | COC(=O)c1cc(C=O)nc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C14H10N2O3/c1-19-14(18)10-6-8(7-17)15-12-9-4-2-3-5-11(9)16-13(10)12/h2-7,16H,1H3 |
| InChIKey | LCCDSSVKYOHLLA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|