C10H8N2O3 — CID 18354851
methyl 2-formyl-1H-benzimidazole-4-carboxylate (PubChem CID 18354851) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is methyl 2-formyl-1H-benzimidazole-4-carboxylate.
| Compound Name | methyl 2-formyl-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 18354851 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | methyl 2-formyl-1H-benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2[nH]c(C=O)nc12 |
| InChI | InChI=1S/C10H8N2O3/c1-15-10(14)6-3-2-4-7-9(6)12-8(5-13)11-7/h2-5H,1H3,(H,11,12) |
| InChIKey | GGFADINAADMKTH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|