C21H25N2O7P — CID 14254626
methyl 2-[(E)-2-(4-butoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid (PubChem CID 14254626) has the molecular formula C21H25N2O7P and a molecular weight of 448.41 g/mol. Its IUPAC name is methyl 2-[(E)-2-(4-butoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid.
| Compound Name | methyl 2-[(E)-2-(4-butoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid |
|---|---|
| PubChem CID | 14254626 |
| Molecular Formula | C21H25N2O7P |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | methyl 2-[(E)-2-(4-butoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid |
| SMILES | CCCCOc1ccc(/C=C/c2nc3c(C(=O)OC)cccc3[nH]2)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C21H22N2O3.H3O4P/c1-3-4-14-26-16-11-8-15(9-12-16)10-13-19-22-18-7-5-6-17(20(18)23-19)21(24)25-2;1-5(2,3)4/h5-13H,3-4,14H2,1-2H3,(H,22,23);(H3,1,2,3,4)/b13-10+; |
| InChIKey | YRILALIBRXUXDB-RSGUCCNWSA-N |
| XLogP | 3.77 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|