C29H26N2O7S — CID 14254666
methyl 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;naphthalene-1-sulfonic acid (PubChem CID 14254666) has the molecular formula C29H26N2O7S and a molecular weight of 546.60 g/mol. Its IUPAC name is methyl 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;naphthalene-1-sulfonic acid.
| Compound Name | methyl 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 14254666 |
| Molecular Formula | C29H26N2O7S |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | methyl 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;naphthalene-1-sulfonic acid |
| SMILES | COC(=O)c1cccc2[nH]c(/C=C/c3ccc(OC)c(OC)c3)nc12.O=S(=O)(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H18N2O4.C10H8O3S/c1-23-15-9-7-12(11-16(15)24-2)8-10-17-20-14-6-4-5-13(18(14)21-17)19(22)25-3;11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10/h4-11H,1-3H3,(H,20,21);1-7H,(H,11,12,13)/b10-8+; |
| InChIKey | YOARGJHIBXJIEK-VRTOBVRTSA-N |
| XLogP | 5.62 |
| TPSA | 127.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|