C19H20N2O7S — CID 173403529
2-[2-(3,4-dimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylic acid;methanesulfonic acid (PubChem CID 173403529) has the molecular formula C19H20N2O7S and a molecular weight of 420.44 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylic acid;methanesulfonic acid.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 173403529 |
| Molecular Formula | C19H20N2O7S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylic acid;methanesulfonic acid |
| SMILES | COc1ccc(C=Cc2nc3c(C(=O)O)cccc3[nH]2)cc1OC.CS(=O)(=O)O |
| InChI | InChI=1S/C18H16N2O4.CH4O3S/c1-23-14-8-6-11(10-15(14)24-2)7-9-16-19-13-5-3-4-12(18(21)22)17(13)20-16;1-5(2,3)4/h3-10H,1-2H3,(H,19,20)(H,21,22);1H3,(H,2,3,4) |
| InChIKey | XQECSKOEINEHLA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 138.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|