C21H20N2O4 — CID 14254615
methyl 2-[(E)-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate (PubChem CID 14254615) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 2-[(E)-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate.
| Compound Name | methyl 2-[(E)-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 14254615 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | methyl 2-[(E)-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate |
| SMILES | C=CCOc1ccc(/C=C/c2nc3c(C(=O)OC)cccc3[nH]2)cc1OC |
| InChI | InChI=1S/C21H20N2O4/c1-4-12-27-17-10-8-14(13-18(17)25-2)9-11-19-22-16-7-5-6-15(20(16)23-19)21(24)26-3/h4-11,13H,1,12H2,2-3H3,(H,22,23)/b11-9+ |
| InChIKey | GFKWTUGEQPZFSG-PKNBQFBNSA-N |
| XLogP | 4.09 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|