C25H24N2O7S — CID 14254667
benzenesulfonic acid;methyl 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate (PubChem CID 14254667) has the molecular formula C25H24N2O7S and a molecular weight of 496.54 g/mol. Its IUPAC name is benzenesulfonic acid;methyl 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate.
| Compound Name | benzenesulfonic acid;methyl 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 14254667 |
| Molecular Formula | C25H24N2O7S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | benzenesulfonic acid;methyl 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2[nH]c(/C=C/c3ccc(OC)c(OC)c3)nc12.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O4.C6H6O3S/c1-23-15-9-7-12(11-16(15)24-2)8-10-17-20-14-6-4-5-13(18(14)21-17)19(22)25-3;7-10(8,9)6-4-2-1-3-5-6/h4-11H,1-3H3,(H,20,21);1-5H,(H,7,8,9)/b10-8+; |
| InChIKey | YTMOPWYSGOKNMA-VRTOBVRTSA-N |
| XLogP | 4.47 |
| TPSA | 127.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|