C18H13F2N2O4- — CID 21293611
2-[(E)-2-[3-(difluoromethoxy)-4-methoxyphenyl]ethenyl]-1H-benzimidazole-4-carboxylate (PubChem CID 21293611) has the molecular formula C18H13F2N2O4- and a molecular weight of 359.31 g/mol. Its IUPAC name is 2-[(E)-2-[3-(difluoromethoxy)-4-methoxyphenyl]ethenyl]-1H-benzimidazole-4-carboxylate.
| Compound Name | 2-[(E)-2-[3-(difluoromethoxy)-4-methoxyphenyl]ethenyl]-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 21293611 |
| Molecular Formula | C18H13F2N2O4- |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-[(E)-2-[3-(difluoromethoxy)-4-methoxyphenyl]ethenyl]-1H-benzimidazole-4-carboxylate |
| SMILES | COc1ccc(/C=C/c2nc3c(C(=O)[O-])cccc3[nH]2)cc1OC(F)F |
| InChI | InChI=1S/C18H14F2N2O4/c1-25-13-7-5-10(9-14(13)26-18(19)20)6-8-15-21-12-4-2-3-11(17(23)24)16(12)22-15/h2-9,18H,1H3,(H,21,22)(H,23,24)/p-1/b8-6+ |
| InChIKey | FCVPGUVOYLTFLK-SOFGYWHQSA-M |
| XLogP | 2.71 |
| TPSA | 87.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |