C20H23N2O9P — CID 14254687
methyl 2-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid (PubChem CID 14254687) has the molecular formula C20H23N2O9P and a molecular weight of 466.38 g/mol. Its IUPAC name is methyl 2-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid.
| Compound Name | methyl 2-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid |
|---|---|
| PubChem CID | 14254687 |
| Molecular Formula | C20H23N2O9P |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | methyl 2-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid |
| SMILES | COC(=O)c1cccc2[nH]c(/C=C/c3c(OC)cc(OC)cc3OC)nc12.O=P(O)(O)O |
| InChI | InChI=1S/C20H20N2O5.H3O4P/c1-24-12-10-16(25-2)13(17(11-12)26-3)8-9-18-21-15-7-5-6-14(19(15)22-18)20(23)27-4;1-5(2,3)4/h5-11H,1-4H3,(H,21,22);(H3,1,2,3,4)/b9-8+; |
| InChIKey | YJUHBCOXBNARMZ-HRNDJLQDSA-N |
| XLogP | 2.62 |
| TPSA | 160.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|