C20H23N2O7P — CID 160582204
methyl 2-[(E)-2-(4-propoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid (PubChem CID 160582204) has the molecular formula C20H23N2O7P and a molecular weight of 434.39 g/mol. Its IUPAC name is methyl 2-[(E)-2-(4-propoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid.
| Compound Name | methyl 2-[(E)-2-(4-propoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid |
|---|---|
| PubChem CID | 160582204 |
| Molecular Formula | C20H23N2O7P |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | methyl 2-[(E)-2-(4-propoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid |
| SMILES | CCCOc1ccc(/C=C/c2nc3c(C(=O)OC)cccc3[nH]2)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C20H20N2O3.H3O4P/c1-3-13-25-15-10-7-14(8-11-15)9-12-18-21-17-6-4-5-16(19(17)22-18)20(23)24-2;1-5(2,3)4/h4-12H,3,13H2,1-2H3,(H,21,22);(H3,1,2,3,4)/b12-9+; |
| InChIKey | RBXSUWRIKWZUCW-NBYYMMLRSA-N |
| XLogP | 3.38 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|