C11H12N2O3 — CID 115357702
methyl 2-[(1S)-1-hydroxyethyl]-1H-benzimidazole-4-carboxylate (PubChem CID 115357702) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is methyl 2-[(1S)-1-hydroxyethyl]-1H-benzimidazole-4-carboxylate.
| Compound Name | methyl 2-[(1S)-1-hydroxyethyl]-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 115357702 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | methyl 2-[(1S)-1-hydroxyethyl]-1H-benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2[nH]c([C@H](C)O)nc12 |
| InChI | InChI=1S/C11H12N2O3/c1-6(14)10-12-8-5-3-4-7(9(8)13-10)11(15)16-2/h3-6,14H,1-2H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | HKFIOMOHYCICMD-LURJTMIESA-N |
| XLogP | 1.40 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |