C17H16N2O2 — CID 115357707
methyl 2-(2-ethylphenyl)-1H-benzimidazole-4-carboxylate (PubChem CID 115357707) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is methyl 2-(2-ethylphenyl)-1H-benzimidazole-4-carboxylate.
| Compound Name | methyl 2-(2-ethylphenyl)-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 115357707 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | methyl 2-(2-ethylphenyl)-1H-benzimidazole-4-carboxylate |
| SMILES | CCc1ccccc1-c1nc2c(C(=O)OC)cccc2[nH]1 |
| InChI | InChI=1S/C17H16N2O2/c1-3-11-7-4-5-8-12(11)16-18-14-10-6-9-13(15(14)19-16)17(20)21-2/h4-10H,3H2,1-2H3,(H,18,19) |
| InChIKey | RWUKGWKOPNFXNJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |