C15H14N2O2S — CID 115357561
methyl 2-(5-ethylthiophen-2-yl)-1H-benzimidazole-4-carboxylate (PubChem CID 115357561) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is methyl 2-(5-ethylthiophen-2-yl)-1H-benzimidazole-4-carboxylate.
| Compound Name | methyl 2-(5-ethylthiophen-2-yl)-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 115357561 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | methyl 2-(5-ethylthiophen-2-yl)-1H-benzimidazole-4-carboxylate |
| SMILES | CCc1ccc(-c2nc3c(C(=O)OC)cccc3[nH]2)s1 |
| InChI | InChI=1S/C15H14N2O2S/c1-3-9-7-8-12(20-9)14-16-11-6-4-5-10(13(11)17-14)15(18)19-2/h4-8H,3H2,1-2H3,(H,16,17) |
| InChIKey | BTNFAAUNPXCJGK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |