C14H12N2O3S — CID 115357609
methyl 2-(4-methoxythiophen-2-yl)-1H-benzimidazole-4-carboxylate (PubChem CID 115357609) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is methyl 2-(4-methoxythiophen-2-yl)-1H-benzimidazole-4-carboxylate.
| Compound Name | methyl 2-(4-methoxythiophen-2-yl)-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 115357609 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | methyl 2-(4-methoxythiophen-2-yl)-1H-benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2[nH]c(-c3cc(OC)cs3)nc12 |
| InChI | InChI=1S/C14H12N2O3S/c1-18-8-6-11(20-7-8)13-15-10-5-3-4-9(12(10)16-13)14(17)19-2/h3-7H,1-2H3,(H,15,16) |
| InChIKey | OKKXLGLXXMXWGP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |