C12H14N2O4S — CID 113422213
methyl 2-(1-methylsulfonylethyl)-1H-benzimidazole-4-carboxylate (PubChem CID 113422213) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is methyl 2-(1-methylsulfonylethyl)-1H-benzimidazole-4-carboxylate.
| Compound Name | methyl 2-(1-methylsulfonylethyl)-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 113422213 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | methyl 2-(1-methylsulfonylethyl)-1H-benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2[nH]c(C(C)S(C)(=O)=O)nc12 |
| InChI | InChI=1S/C12H14N2O4S/c1-7(19(3,16)17)11-13-9-6-4-5-8(10(9)14-11)12(15)18-2/h4-7H,1-3H3,(H,13,14) |
| InChIKey | JJFMIMVEOFQGBS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |