C18H19N3O2 — CID 143959536
methyl 2-(2,4,6-trimethylanilino)-1H-benzimidazole-4-carboxylate (PubChem CID 143959536) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is methyl 2-(2,4,6-trimethylanilino)-1H-benzimidazole-4-carboxylate.
| Compound Name | methyl 2-(2,4,6-trimethylanilino)-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 143959536 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | methyl 2-(2,4,6-trimethylanilino)-1H-benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2[nH]c(Nc3c(C)cc(C)cc3C)nc12 |
| InChI | InChI=1S/C18H19N3O2/c1-10-8-11(2)15(12(3)9-10)20-18-19-14-7-5-6-13(16(14)21-18)17(22)23-4/h5-9H,1-4H3,(H2,19,20,21) |
| InChIKey | JWXVUGOPBVCNNN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |