C15H16N4 — CID 91455813
N-(2,4,6-trimethylphenyl)-1H-imidazo[4,5-b]pyridin-2-amine (PubChem CID 91455813) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is N-(2,4,6-trimethylphenyl)-1H-imidazo[4,5-b]pyridin-2-amine.
| Compound Name | N-(2,4,6-trimethylphenyl)-1H-imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 91455813 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N-(2,4,6-trimethylphenyl)-1H-imidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1cc(C)c(Nc2nc3ncccc3[nH]2)c(C)c1 |
| InChI | InChI=1S/C15H16N4/c1-9-7-10(2)13(11(3)8-9)18-15-17-12-5-4-6-16-14(12)19-15/h4-8H,1-3H3,(H2,16,17,18,19) |
| InChIKey | DCKNUFPRGLTUIJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |