C14H12N2O2 — CID 13351962
methyl 4-methyl-5H-pyrido[4,3-b]indole-1-carboxylate (PubChem CID 13351962) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl 4-methyl-5H-pyrido[4,3-b]indole-1-carboxylate.
| Compound Name | methyl 4-methyl-5H-pyrido[4,3-b]indole-1-carboxylate |
|---|---|
| PubChem CID | 13351962 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | methyl 4-methyl-5H-pyrido[4,3-b]indole-1-carboxylate |
| SMILES | COC(=O)c1ncc(C)c2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C14H12N2O2/c1-8-7-15-13(14(17)18-2)11-9-5-3-4-6-10(9)16-12(8)11/h3-7,16H,1-2H3 |
| InChIKey | CHBHHUKJMJOZMB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |