C18H18N2O4 — CID 102268938
diethyl 4-methyl-5H-pyrido[4,3-b]indole-1,3-dicarboxylate (PubChem CID 102268938) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is diethyl 4-methyl-5H-pyrido[4,3-b]indole-1,3-dicarboxylate.
| Compound Name | diethyl 4-methyl-5H-pyrido[4,3-b]indole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 102268938 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | diethyl 4-methyl-5H-pyrido[4,3-b]indole-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1nc(C(=O)OCC)c2c([nH]c3ccccc32)c1C |
| InChI | InChI=1S/C18H18N2O4/c1-4-23-17(21)15-10(3)14-13(16(20-15)18(22)24-5-2)11-8-6-7-9-12(11)19-14/h6-9,19H,4-5H2,1-3H3 |
| InChIKey | XDLJPRAUZWLBMO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |