C16H14N2O4 — CID 102040877
1-O-ethyl 3-O-methyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate (PubChem CID 102040877) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 1-O-ethyl 3-O-methyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate.
| Compound Name | 1-O-ethyl 3-O-methyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 102040877 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-O-ethyl 3-O-methyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1nc(C(=O)OC)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C16H14N2O4/c1-3-22-16(20)14-13-10(8-12(18-14)15(19)21-2)9-6-4-5-7-11(9)17-13/h4-8,17H,3H2,1-2H3 |
| InChIKey | KRJFHZLTPINIHY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |